Online Database of Chemicals from Around the World
|
CAS#: 832744-28-2 Product: 1-Bromo-4-[(4-chlorophenyl)ethynyl]benzene No suppilers available for the product. |
| Name | 1-Bromo-4-[(4-chlorophenyl)ethynyl]benzene |
|---|---|
| Synonyms | 1-Brom-4-[(4-chlorphenyl)ethinyl]benzol; 1-Bromo-4-[(4-chlorophenyl)ethynyl]benzene; 1-Bromo-4-[(4-chlorophényl)éthynyl]benzène |
| Molecular Structure | ![CAS#: 832744-28-2, 1-Bromo-4-[(4-chlorophenyl)ethynyl]benzene](/moreStructures/832744-28-2.gif) |
| Molecular Formula | C14H8BrCl |
| Molecular Weight | 291.57 |
| CAS Registry Number | 832744-28-2 |
| SMILES | c1cc(ccc1C#Cc2ccc(cc2)Br)Cl |
| InChI | 1S/C14H8BrCl/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H |
| InChIKey | GOVDQARNNMIPTP-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.1±27.0°C at 760 mmHg (Cal.) |
| Flash point | 201.1±13.8°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-4-[(4-chlorophenyl)ethynyl]benzene |