|
CAS#: 83275-34-7 Product: Allyl 3,3-Dichloro-2,2,3-Trifluoropropionate No suppilers available for the product. |
| Name | Allyl 3,3-Dichloro-2,2,3-Trifluoropropionate |
|---|---|
| Synonyms | Allyl 3,3-Dichloro-2,2,3-Trifluoro-Propanoate; 3,3-Dichloro-2,2,3-Trifluoropropanoic Acid Allyl Ester; 3,3-Dichloro-2,2,3-Trifluoro-Propionic Acid Allyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5Cl2F3O2 |
| Molecular Weight | 237.01 |
| CAS Registry Number | 83275-34-7 |
| EINECS | 280-361-0 |
| SMILES | C(OC(=O)C(F)(F)C(Cl)(Cl)F)C=C |
| InChI | 1S/C6H5Cl2F3O2/c1-2-3-13-4(12)5(9,10)6(7,8)11/h2H,1,3H2 |
| InChIKey | YDSNWHBOQDVWSF-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Allyl 3,3-Dichloro-2,2,3-Trifluoropropionate |