|
CAS#: 833-43-2 Product: 2-Nitrophenethyl Acetate No suppilers available for the product. |
| Name | 2-Nitrophenethyl Acetate |
|---|---|
| Synonyms | Acetic Acid 2-(2-Nitrophenyl)Ethyl Ester; 2-(2-Nitrophenyl)Ethyl Ethanoate; Benzeneethanol, Ar-Nitro-, Acetate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 833-43-2 |
| EINECS | 212-628-4 |
| SMILES | C1=CC(=C(C=C1)CCOC(=O)C)[N+]([O-])=O |
| InChI | 1S/C10H11NO4/c1-8(12)15-7-6-9-4-2-3-5-10(9)11(13)14/h2-5H,6-7H2,1H3 |
| InChIKey | JTDNAYJQWWTNDA-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.719°C at 760 mmHg (Cal.) |
| Flash point | 134.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitrophenethyl Acetate |