|
CAS#: 83408-77-9 Product: ((2-Methylphenyl)Amino)-Ethanethioic Acid S-1H-Benzimidazol-2-Yl Ester No suppilers available for the product. |
| Name | ((2-Methylphenyl)Amino)-Ethanethioic Acid S-1H-Benzimidazol-2-Yl Ester |
|---|---|
| Synonyms | 2-[(2-Methylphenyl)Amino]Ethanethioic Acid S-(1H-Benzimidazol-2-Yl) Ester; ((2-Methylphenyl)Amino)Ethanethioic Acid S-1H-Benzimidazol-2-Yl Ester; Brn 4522830 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.37 |
| CAS Registry Number | 83408-77-9 |
| SMILES | C1=C(C(=CC=C1)NCC(=O)SC3=NC2=CC=CC=C2[NH]3)C |
| InChI | 1S/C16H15N3OS/c1-11-6-2-3-7-12(11)17-10-15(20)21-16-18-13-8-4-5-9-14(13)19-16/h2-9,17H,10H2,1H3,(H,18,19) |
| InChIKey | DUIVDAQNVYDUTJ-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.07°C at 760 mmHg (Cal.) |
| Flash point | 290.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ((2-Methylphenyl)Amino)-Ethanethioic Acid S-1H-Benzimidazol-2-Yl Ester |