|
CAS#: 83465-15-0 Product: Morphine 3-Nicotinate No suppilers available for the product. |
| Name | Morphine 3-Nicotinate |
|---|---|
| Synonyms | 3-Nicotinoylmorphine; Morphinan-3,6-Diol, 7,8-Didehydro-4,5-Epoxy-17-Methyl- (5Alpha,6Alpha)-, 3-(3-Pyridinecarboxylate); Morphine 3-Nicotinate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 |
| CAS Registry Number | 83465-15-0 |
| SMILES | [C@]234C1=C5C=CC(=C1O[C@H]2[C@@H](O)C=C[C@H]3[C@@H](N(C)CC4)C5)OC(C6=CN=CC=C6)=O |
| InChI | 1S/C23H22N2O4/c1-25-10-8-23-15-5-6-17(26)21(23)29-20-18(7-4-13(19(20)23)11-16(15)25)28-22(27)14-3-2-9-24-12-14/h2-7,9,12,15-17,21,26H,8,10-11H2,1H3/t15-,16-,17-,21-,23-/m0/s1 |
| InChIKey | RPXDXNICIYHIEN-KHNXIZHXSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.175°C at 760 mmHg (Cal.) |
| Flash point | 328.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Morphine 3-Nicotinate |