|
CAS#: 83521-87-3 Product: 2-Phenyl-2-(2-Thienyl)-1,3-Dithiolane No suppilers available for the product. |
| Name | 2-Phenyl-2-(2-Thienyl)-1,3-Dithiolane |
|---|---|
| Synonyms | 2-Phenyl-2-(2-Thienyl)-1,3-Dithiolane; 1,3-Dithiolane, 2-Phenyl-2-(2-Thienyl)-; 4-19-00-04762 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12S3 |
| Molecular Weight | 264.42 |
| CAS Registry Number | 83521-87-3 |
| SMILES | C3=C(C2(C1=CC=CC=C1)SCCS2)SC=C3 |
| InChI | 1S/C13H12S3/c1-2-5-11(6-3-1)13(15-9-10-16-13)12-7-4-8-14-12/h1-8H,9-10H2 |
| InChIKey | XUAUFQHMFHDIDV-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.612°C at 760 mmHg (Cal.) |
| Flash point | 199.107°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-2-(2-Thienyl)-1,3-Dithiolane |