|
CAS#: 83541-82-6 Product: 2-Amino-6,7-Dihydroxybenzonorbornene No suppilers available for the product. |
| Name | 2-Amino-6,7-Dihydroxybenzonorbornene |
|---|---|
| Synonyms | 2-Amino-6,7-Dihydroxybenzonorbornene; 2-Dhbb |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 83541-82-6 |
| SMILES | [C@@H]12C3=C([C@@H](C1)C[C@H]2N)C=C(O)C(=C3)O |
| InChI | 1S/C11H13NO2/c12-9-2-5-1-8(9)7-4-11(14)10(13)3-6(5)7/h3-5,8-9,13-14H,1-2,12H2/t5-,8-,9+/m0/s1 |
| InChIKey | QPAZOFORCJMYGG-WLGLDCGKSA-N |
| Density | 1.371g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.122°C at 760 mmHg (Cal.) |
| Flash point | 184.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6,7-Dihydroxybenzonorbornene |