|
CAS#: 83567-02-6 Product: 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitrocyclohex-2-En-1-One No suppilers available for the product. |
| Name | 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitrocyclohex-2-En-1-One |
|---|---|
| Synonyms | 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitro-Cyclohex-2-En-1-One; 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitro-1-Cyclohex-2-Enone; 2-Cyclohexen-1-One, 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 |
| CAS Registry Number | 83567-02-6 |
| EINECS | 280-487-6 |
| SMILES | CC1(C(=C(O)C(=O)C(C1)(C)C)[N+]([O-])=O)C |
| InChI | 1S/C10H15NO4/c1-9(2)5-10(3,4)8(13)6(12)7(9)11(14)15/h12H,5H2,1-4H3 |
| InChIKey | XUKDJCXTIFFHIE-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.179°C at 760 mmHg (Cal.) |
| Flash point | 119.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-4,4,6,6-Tetramethyl-3-Nitrocyclohex-2-En-1-One |