|
CAS#: 83573-57-3 Product: 4-(Propoxycarbonyl)phenyl 4-methyl-3-nitrobenzoate No suppilers available for the product. |
| Name | 4-(Propoxycarbonyl)phenyl 4-methyl-3-nitrobenzoate |
|---|---|
| Synonyms | p-(propoxycarbonyl)phenyl 3-nitro-p-toluate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.33 |
| CAS Registry Number | 83573-57-3 |
| EINECS | 280-491-8 |
| SMILES | O=C(Oc1ccc(cc1)C(=O)OCCC)c2ccc(C)c(c2)[N+]([O-])=O |
| InChI | 1S/C18H17NO6/c1-3-10-24-17(20)13-6-8-15(9-7-13)25-18(21)14-5-4-12(2)16(11-14)19(22)23/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | JOUQWHISQQFODR-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.015°C at 760 mmHg (Cal.) |
| Flash point | 203.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Propoxycarbonyl)phenyl 4-methyl-3-nitrobenzoate |