|
CAS#: 83588-53-8 Product: Ethyl Ethylene Sulfate No suppilers available for the product. |
| Name | Ethyl Ethylene Sulfate |
|---|---|
| Synonyms | Sulfuric Acid 2-Ethoxysulfonyloxyethyl Ethyl Ester; Ethyl Ethylene Sulfate (7Ci); Ethyleneglycol Diethylsulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14O8S2 |
| Molecular Weight | 278.29 |
| CAS Registry Number | 83588-53-8 |
| SMILES | C(O[S](=O)(OCC)=O)CO[S](=O)(OCC)=O |
| InChI | 1S/C6H14O8S2/c1-3-11-15(7,8)13-5-6-14-16(9,10)12-4-2/h3-6H2,1-2H3 |
| InChIKey | XXIJPFMMIJZFHY-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.842°C at 760 mmHg (Cal.) |
| Flash point | 207.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Ethylene Sulfate |