|
CAS#: 83626-94-2 Product: 4-(2-(4-Chloro-N-Methylbenzamido)Phenyl)-Butyric Acid No suppilers available for the product. |
| Name | 4-(2-(4-Chloro-N-Methylbenzamido)Phenyl)-Butyric Acid |
|---|---|
| Synonyms | 4-[2-[(4-Chlorobenzoyl)-Methyl-Amino]Phenyl]Butanoic Acid; 4-[2-[[(4-Chlorophenyl)-Oxomethyl]-Methylamino]Phenyl]Butanoic Acid; 4-[2-[(4-Chlorobenzoyl)-Methyl-Amino]Phenyl]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 |
| CAS Registry Number | 83626-94-2 |
| SMILES | C1=C(C(=CC=C1)CCCC(=O)O)N(C)C(C2=CC=C(C=C2)Cl)=O |
| InChI | 1S/C18H18ClNO3/c1-20(18(23)14-9-11-15(19)12-10-14)16-7-3-2-5-13(16)6-4-8-17(21)22/h2-3,5,7,9-12H,4,6,8H2,1H3,(H,21,22) |
| InChIKey | MBJNPFAFGCCJCR-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.085°C at 760 mmHg (Cal.) |
| Flash point | 267.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-(4-Chloro-N-Methylbenzamido)Phenyl)-Butyric Acid |