|
CAS#: 83658-44-0 Product: 3,4-Dihydro-N,N-Dimethyl-1-(3-Methylphenyl)-3-Isoquinolineethanamine Ethanedioate (1:2) No suppilers available for the product. |
| Name | 3,4-Dihydro-N,N-Dimethyl-1-(3-Methylphenyl)-3-Isoquinolineethanamine Ethanedioate (1:2) |
|---|---|
| Synonyms | 3-Isoquinolineethanamine, 3,4-Dihydro-N,N-Dimethyl-1-(3-Methylphenyl)-, Ethanedioate (1:2) |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 |
| CAS Registry Number | 83658-44-0 |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.C(C1N=C(C2=C(C1)C=CC=C2)C3=CC=CC(=C3)C)CN(C)C |
| InChI | 1S/C20H24N2.2C2H2O4/c1-15-7-6-9-17(13-15)20-19-10-5-4-8-16(19)14-18(21-20)11-12-22(2)3;2*3-1(4)2(5)6/h4-10,13,18H,11-12,14H2,1-3H3;2*(H,3,4)(H,5,6) |
| InChIKey | VTNZZGOZCBWINL-UHFFFAOYSA-N |
| Boiling point | 409.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-N,N-Dimethyl-1-(3-Methylphenyl)-3-Isoquinolineethanamine Ethanedioate (1:2) |