|
CAS#: 83685-19-2 Product: Fissistigine C No suppilers available for the product. |
| Name | Fissistigine C |
|---|---|
| Synonyms | Fissistigine C |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 |
| CAS Registry Number | 83685-19-2 |
| SMILES | [C@@H]14N(CCC2=C1C(=CC(=C2)OC)OC3=C(OC)C=C(OC)C=C3C4)C |
| InChI | 1S/C20H23NO4/c1-21-6-5-12-7-14(22-2)10-17-19(12)16(21)9-13-8-15(23-3)11-18(24-4)20(13)25-17/h7-8,10-11,16H,5-6,9H2,1-4H3/t16-/m0/s1 |
| InChIKey | KXSQCYVMSJZRRS-INIZCTEOSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.686°C at 760 mmHg (Cal.) |
| Flash point | 148.138°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fissistigine C |