Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Cambridge Isotope Laboratories, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (978) 749-8000 | |||
|
cilsales@isotope.com | |||
| Chemical manufacturer | ||||
| Name | 2-[1-(4-Hydroxyphenyl)-1-Methylethyl]Phenol |
|---|---|
| Synonyms | 2-[1-(4-Hydroxyphenyl)-1-Methyl-Ethyl]Phenol; 2-[1-(4-Hydroxyphenyl)-1-Methylethyl]Phenol; Zinc01509568 |
| Molecular Structure | ![CAS#: 837-08-1, 2-[1-(4-Hydroxyphenyl)-1-Methylethyl]Phenol](/moreStructures/837-08-1.gif) |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 |
| CAS Registry Number | 837-08-1 |
| EINECS | 212-650-4 |
| SMILES | C1=CC=CC(=C1C(C2=CC=C(O)C=C2)(C)C)O |
| InChI | 1S/C15H16O2/c1-15(2,11-7-9-12(16)10-8-11)13-5-3-4-6-14(13)17/h3-10,16-17H,1-2H3 |
| InChIKey | MLCQXUZZAXKTSG-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.783°C at 760 mmHg (Cal.) |
| Flash point | 181.536°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | E. Rozycka-Sokolowska, B. Marciniak, V. Pavlyuk and E. Dziwinski. 2,4'-Isopropylidenediphenol, Acta Cryst. (2005). C61, o45-o46 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[1-(4-Hydroxyphenyl)-1-Methylethyl]Phenol |