Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,2,3,6-Tetrachloro-Dibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,6-Tetrachloro; Dibenzofuran, 1,2,3,6-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl4O |
| Molecular Weight | 305.98 |
| CAS Registry Number | 83704-21-6 |
| SMILES | C1=C2C(=C(C=C1)Cl)OC3=C2C(=C(C(=C3)Cl)Cl)Cl |
| InChI | 1S/C12H4Cl4O/c13-6-3-1-2-5-9-8(17-12(5)6)4-7(14)10(15)11(9)16/h1-4H |
| InChIKey | BBAXFLIBRPXRBP-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.128°C at 760 mmHg (Cal.) |
| Flash point | 207.886°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6-Tetrachloro-Dibenzofuran |