|
CAS#: 83711-60-8 Product: 3-[(2E)-3-(4-Nitrophenyl)-2-triazen-1-yl]-2-butanone No suppilers available for the product. |
| Name | 3-[(2E)-3-(4-Nitrophenyl)-2-triazen-1-yl]-2-butanone |
|---|---|
| Synonyms | 3-[3-(4-nitrophenyl)triazen-1-yl]butan-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 83711-60-8 |
| EINECS | 280-558-1 |
| SMILES | CC(=O)C(C)N=NNc1ccc(cc1)[N+]([O-])=O |
| InChI | 1S/C10H12N4O3/c1-7(8(2)15)11-13-12-9-3-5-10(6-4-9)14(16)17/h3-7H,1-2H3,(H,11,12) |
| InChIKey | ZMTRZXXDZGOIOP-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.738°C at 760 mmHg (Cal.) |
| Flash point | 165.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(2E)-3-(4-Nitrophenyl)-2-triazen-1-yl]-2-butanone |