|
CAS#: 83733-82-8 Product: Fosmethilan No suppilers available for the product. |
| Name | Fosmethilan |
|---|---|
| Synonyms | N-(2-Chlorophenyl)-N-[(Dimethoxyphosphinothioylthio)Methyl]Butanamide; N-(2-Chlorophenyl)-N-[(Dimethoxythiophosphorylthio)Methyl]Butyramide; Brn 5111838 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19ClNO3PS2 |
| Molecular Weight | 367.84 |
| CAS Registry Number | 83733-82-8 |
| SMILES | C1=C(C(=CC=C1)N(CS[P](=S)(OC)OC)C(=O)CCC)Cl |
| InChI | 1S/C13H19ClNO3PS2/c1-4-7-13(16)15(10-21-19(20,17-2)18-3)12-9-6-5-8-11(12)14/h5-6,8-9H,4,7,10H2,1-3H3 |
| InChIKey | MVBGKYGTNGPFHT-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.947°C at 760 mmHg (Cal.) |
| Flash point | 230.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fosmethilan |