|
CAS#: 83781-02-6 Product: [(1S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid - 6-methyl-2-heptanamine (1:1) No suppilers available for the product. |
| Name | [(1S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid - 6-methyl-2-heptanamine (1:1) |
|---|---|
| Synonyms | (1,5-dimethylhexyl)amine (1S)-2-oxobornane-10-sulphonate; (1,5-dimethylhexyl)ammonium (1S)-2-oxobornane-10-sulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H35NO4S |
| Molecular Weight | 361.54 |
| CAS Registry Number | 83781-02-6 |
| EINECS | 280-779-3 |
| SMILES | CC(C)CCCC(C)N.OS(=O)(=O)C[C@]12CCC(CC1=O)C2(C)C |
| InChI | 1S/C10H16O4S.C8H19N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-7(2)5-4-6-8(3)9/h7H,3-6H2,1-2H3,(H,12,13,14);7-8H,4-6,9H2,1-3H3/t7?,10-;/m1./s1 |
| InChIKey | IJUZWPVVLRFXDI-DLGLCQKISA-N |
| Boiling point | 497.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 254.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid - 6-methyl-2-heptanamine (1:1) |