|
CAS#: 83783-86-2 Product: 3-Methyl-2-Butenyl 2-Methylcrotonate No suppilers available for the product. |
| Name | 3-Methyl-2-Butenyl 2-Methylcrotonate |
|---|---|
| Synonyms | (E)-2-Methylbut-2-Enoic Acid 3-Methylbut-2-Enyl Ester; 3-Methyl-2-Butenyl 2-Methylcrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 83783-86-2 |
| EINECS | 280-821-0 |
| SMILES | C(OC(=O)C(=C/C)/C)C=C(C)C |
| InChI | 1S/C10H16O2/c1-5-9(4)10(11)12-7-6-8(2)3/h5-6H,7H2,1-4H3/b9-5+ |
| InChIKey | WTDWXMWAIMIKSI-WEVVVXLNSA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.214°C at 760 mmHg (Cal.) |
| Flash point | 88.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-Butenyl 2-Methylcrotonate |