|
CAS#: 83803-78-5 Product: 6-(acetylamino)-4-hydroxy-3-[2-(3-phosphonatophenyl)diazenyl]-2-Naphthalenesulfonate ammonium salt (1:2) No suppilers available for the product. |
| Name | 6-(acetylamino)-4-hydroxy-3-[2-(3-phosphonatophenyl)diazenyl]-2-Naphthalenesulfonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21N5O8PS |
| Molecular Weight | 498.43 |
| CAS Registry Number | 83803-78-5 |
| EINECS | 280-897-5 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)c1cccc(c1)N=Nc3c(cc2ccc(cc2c3O)NC(C)=O)S([O-])(=O)=O |
| InChI | 1S/C18H16N3O8PS.2H3N/c1-10(22)19-12-6-5-11-7-16(31(27,28)29)17(18(23)15(11)9-12)21-20-13-3-2-4-14(8-13)30(24,25)26;;/h2-9,23H,1H3,(H,19,22)(H2,24,25,26)(H,27,28,29);2*1H3/p-1 |
| InChIKey | BGYXBWZKPPVQGT-UHFFFAOYSA-M |
| Boiling point | 1005°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 561.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(acetylamino)-4-hydroxy-3-[2-(3-phosphonatophenyl)diazenyl]-2-Naphthalenesulfonate ammonium salt (1:2) |