|
CAS#: 83803-97-8 Product: 2'-(4-Methylbenzoyl)-1-Naphthohydrazide No suppilers available for the product. |
| Name | 2'-(4-Methylbenzoyl)-1-Naphthohydrazide |
|---|---|
| Synonyms | N'-[(4-Methylphenyl)-Oxomethyl]-1-Naphthalenecarbohydrazide; N'-(4-Methylphenyl)Carbonylnaphthalene-1-Carbohydrazide; Nsc88893 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 |
| CAS Registry Number | 83803-97-8 |
| EINECS | 280-918-8 |
| SMILES | C1=CC=CC2=CC=CC(=C12)C(NNC(C3=CC=C(C)C=C3)=O)=O |
| InChI | 1S/C19H16N2O2/c1-13-9-11-15(12-10-13)18(22)20-21-19(23)17-8-4-6-14-5-2-3-7-16(14)17/h2-12H,1H3,(H,20,22)(H,21,23) |
| InChIKey | FMSOLSNSLBVFBF-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.272°C at 760 mmHg (Cal.) |
| Flash point | 224.548°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2'-(4-Methylbenzoyl)-1-Naphthohydrazide |