|
CAS#: 83817-57-6 Product: 2-Chloro-3-Methyl-9H-Thioxanthen-9-One No suppilers available for the product. |
| Name | 2-Chloro-3-Methyl-9H-Thioxanthen-9-One |
|---|---|
| Synonyms | 2-Chloro-3-Methyl-Thioxanthen-9-One; 2-Chloro-3-Methyl-9-Thioxanthenone; 2-Chloro-3-Methyl-9H-Thioxanthen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9ClOS |
| Molecular Weight | 260.74 |
| CAS Registry Number | 83817-57-6 |
| EINECS | 280-958-6 |
| SMILES | C1=C(Cl)C(=CC2=C1C(=O)C3=C(S2)C=CC=C3)C |
| InChI | 1S/C14H9ClOS/c1-8-6-13-10(7-11(8)15)14(16)9-4-2-3-5-12(9)17-13/h2-7H,1H3 |
| InChIKey | DEBJMHLLCFSQFY-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.484°C at 760 mmHg (Cal.) |
| Flash point | 216.569°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3-Methyl-9H-Thioxanthen-9-One |