|
CAS#: 83846-62-2 Product: Methyl 1-Phenyl-1H-Imidazole-5-Carboxylate No suppilers available for the product. |
| Name | Methyl 1-Phenyl-1H-Imidazole-5-Carboxylate |
|---|---|
| Synonyms | 3-Phenyl-4-Imidazolecarboxylic Acid Methyl Ester; 3-Phenylimidazole-4-Carboxylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 83846-62-2 |
| EINECS | 281-039-2 |
| SMILES | C1=NC=C([N]1C2=CC=CC=C2)C(OC)=O |
| InChI | 1S/C11H10N2O2/c1-15-11(14)10-7-12-8-13(10)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | CKWUTWFZMPGKGM-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.966°C at 760 mmHg (Cal.) |
| Flash point | 166.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-Phenyl-1H-Imidazole-5-Carboxylate |