|
CAS#: 83850-91-3 Product: N,2-Diphenyl-Glycine 2-(Dimethylamino)Ethyl Ester Maleate No suppilers available for the product. |
| Name | N,2-Diphenyl-Glycine 2-(Dimethylamino)Ethyl Ester Maleate |
|---|---|
| Synonyms | Dimethyl-[2-[2-Phenyl-2-(Phenylamino)Acetyl]Oxyethyl]Ammonium; (Z)-4-Hydroxy-4-Oxo-But-2-Enoate; Dimethyl-[2-[1-Oxo-2-Phenyl-2-(Phenylamino)Ethoxy]Ethyl]Ammonium; (Z)-4-Hydroxy-4-Oxobut-2-Enoate; Dimethyl-[2-[2-Phenyl-2-(Phenylamino)Acetyl]Oxyethyl]Ammonium; (Z)-4-Hydroxy-4-Keto-But-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 |
| CAS Registry Number | 83850-91-3 |
| SMILES | C2=C(C(NC1=CC=CC=C1)C(OCC[NH+](C)C)=O)C=CC=C2.O=C([O-])\C=C/C(=O)O |
| InChI | 1S/C18H22N2O2.C4H4O4/c1-20(2)13-14-22-18(21)17(15-9-5-3-6-10-15)19-16-11-7-4-8-12-16;5-3(6)1-2-4(7)8/h3-12,17,19H,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FCKPPISHFGDBCG-BTJKTKAUSA-N |
| Boiling point | 428°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,2-Diphenyl-Glycine 2-(Dimethylamino)Ethyl Ester Maleate |