Online Database of Chemicals from Around the World
|
CAS#: 83863-78-9 Product: 4-{2-[(2,6-Dichlorophenyl)amino]-2-oxoethyl}-2-piperazinecarboxamide No suppilers available for the product. |
| Name | 4-{2-[(2,6-Dichlorophenyl)amino]-2-oxoethyl}-2-piperazinecarboxamide |
|---|---|
| Synonyms | 3-carbamoyl-N-(2,6-dichlorophenyl)piperazine-1-acetamide |
| Molecular Structure | ![CAS#: 83863-78-9, 4-{2-[(2,6-Dichlorophenyl)amino]-2-oxoethyl}-2-piperazinecarboxamide](/moreStructures/83863-78-9.gif) |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 |
| CAS Registry Number | 83863-78-9 |
| EINECS | 281-144-3 |
| SMILES | O=C(CN1CC(NCC1)C(N)=O)Nc2c(Cl)cccc2Cl |
| InChI | 1S/C13H16Cl2N4O2/c14-8-2-1-3-9(15)12(8)18-11(20)7-19-5-4-17-10(6-19)13(16)21/h1-3,10,17H,4-7H2,(H2,16,21)(H,18,20) |
| InChIKey | MHLJEWPCJZYGOE-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.239°C at 760 mmHg (Cal.) |
| Flash point | 317.418°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{2-[(2,6-Dichlorophenyl)amino]-2-oxoethyl}-2-piperazinecarboxamide |