Online Database of Chemicals from Around the World
|
CAS#: 83877-85-4 Product: 2-Chloro-1,1,1,2,3,3-Hexafluoro-3-[(Trifluorovinyl)Oxy]Propane No suppilers available for the product. |
| Name | 2-Chloro-1,1,1,2,3,3-Hexafluoro-3-[(Trifluorovinyl)Oxy]Propane |
|---|---|
| Synonyms | 1-(2-Chloro-1,1,2,3,3,3-Hexafluoro-Propoxy)-1,2,2-Trifluoro-Ethylene; 2-Chloro-1,1,1,2,3,3-Hexafluoro-3-((Trifluorovinyl)Oxy)Propane |
| Molecular Structure | ![CAS#: 83877-85-4, 2-Chloro-1,1,1,2,3,3-Hexafluoro-3-[(Trifluorovinyl)Oxy]Propane](/moreStructures/83877-85-4.gif) |
| Molecular Formula | C5ClF9O |
| Molecular Weight | 282.49 |
| CAS Registry Number | 83877-85-4 |
| EINECS | 281-154-8 |
| SMILES | C(F)(F)=C(F)OC(F)(F)C(Cl)(F)C(F)(F)F |
| InChI | 1S/C5ClF9O/c6-3(10,4(11,12)13)5(14,15)16-2(9)1(7)8 |
| InChIKey | OLZWAIIFDODWMH-UHFFFAOYSA-N |
| Density | 1.65g/cm3 (Cal.) |
|---|---|
| Boiling point | 85.749°C at 760 mmHg (Cal.) |
| Flash point | 5.661°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,1,1,2,3,3-Hexafluoro-3-[(Trifluorovinyl)Oxy]Propane |