|
CAS#: 83898-12-8 Product: Methyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate No suppilers available for the product. |
| Name | Methyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate |
|---|---|
| Synonyms | methyl N-formyl-3-oxo-N-(1-phenylethyl)-alaninate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26 |
| CAS Registry Number | 83898-12-8 |
| EINECS | 281-220-6 |
| SMILES | COC(=O)C(C=O)N(C=O)C(C)c1ccccc1 |
| InChI | 1S/C13H15NO4/c1-10(11-6-4-3-5-7-11)14(9-16)12(8-15)13(17)18-2/h3-10,12H,1-2H3 |
| InChIKey | YXILPKRGFXXFBH-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.568°C at 760 mmHg (Cal.) |
| Flash point | 204.524°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate |