|
CAS#: 83898-66-2 Product: 4-[3-(2-Cyanopropyl)-1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-8-yl]-1-(4-fluorophenyl)cyclohexanecarbonitrile No suppilers available for the product. |
| Name | 4-[3-(2-Cyanopropyl)-1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-8-yl]-1-(4-fluorophenyl)cyclohexanecarbonitrile |
|---|---|
| Synonyms | cis-8-[4- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H33F2N5O |
| Molecular Weight | 517.61 |
| CAS Registry Number | 83898-66-2 |
| EINECS | 281-278-2 |
| SMILES | Fc1ccc(cc1)C2(C#N)CCC(CC2)N3CCC5(CC3)C(=O)N(CN5c4ccc(F)cc4)CC(C)C#N |
| InChI | 1S/C30H33F2N5O/c1-22(18-33)19-36-21-37(27-8-6-25(32)7-9-27)30(28(36)38)14-16-35(17-15-30)26-10-12-29(20-34,13-11-26)23-2-4-24(31)5-3-23/h2-9,22,26H,10-17,19,21H2,1H3 |
| InChIKey | BKAXWTHYFNJAHF-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 723.113°C at 760 mmHg (Cal.) |
| Flash point | 391.125°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[3-(2-Cyanopropyl)-1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-8-yl]-1-(4-fluorophenyl)cyclohexanecarbonitrile |