|
CAS#: 83929-35-5 Product: Ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate No suppilers available for the product. |
| Name | Ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 |
| CAS Registry Number | 83929-35-5 |
| EINECS | 281-330-4 |
| SMILES | CCOC(=O)N1CCC3(CC1)C(=O)NCN3c2ccccc2 |
| InChI | 1S/C16H21N3O3/c1-2-22-15(21)18-10-8-16(9-11-18)14(20)17-12-19(16)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3,(H,17,20) |
| InChIKey | ZKXWZAXKNCJMQA-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.788°C at 760 mmHg (Cal.) |
| Flash point | 274.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |