Online Database of Chemicals from Around the World
|
CAS#: 83929-78-6 Product: 1-Bromo-2,3,4,5-tetrakis(Bromomethyl)-6-[(2,4,6-Tribromophenoxy)Methyl]Benzene No suppilers available for the product. |
| Name | 1-Bromo-2,3,4,5-tetrakis(Bromomethyl)-6-[(2,4,6-Tribromophenoxy)Methyl]Benzene |
|---|---|
| Synonyms | Bromotetrakis(Bromomethyl)((2,4,6-Tribromophenoxy)Methyl)Benzene |
| Molecular Structure | ![CAS#: 83929-78-6, 1-Bromo-2,3,4,5-tetrakis(Bromomethyl)-6-[(2,4,6-Tribromophenoxy)Methyl]Benzene](/moreStructures/83929-78-6.gif) |
| Molecular Formula | C17H12Br8O |
| Molecular Weight | 871.51 |
| CAS Registry Number | 83929-78-6 |
| EINECS | 281-372-3 |
| SMILES | C1=C(Br)C=C(Br)C(=C1Br)OCC2=C(C(=C(C(=C2Br)CBr)CBr)CBr)CBr |
| InChI | 1S/C17H12Br8O/c18-3-9-10(4-19)12(6-21)16(25)13(11(9)5-20)7-26-17-14(23)1-8(22)2-15(17)24/h1-2H,3-7H2 |
| InChIKey | VUGWCMPLDDRYOU-UHFFFAOYSA-N |
| Density | 2.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 658.802°C at 760 mmHg (Cal.) |
| Flash point | 279.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-2,3,4,5-tetrakis(Bromomethyl)-6-[(2,4,6-Tribromophenoxy)Methyl]Benzene |