|
CAS#: 83984-86-5 Product: (3beta)-3-(Formyloxy)-20-oxopregn-5-en-17-yl acetate No suppilers available for the product. |
| Name | (3beta)-3-(Formyloxy)-20-oxopregn-5-en-17-yl acetate |
|---|---|
| Synonyms | 3β,17-dihydroxypregn-5-en-20-one 17-acetate 3-formate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.52 |
| CAS Registry Number | 83984-86-5 |
| EINECS | 281-609-0 |
| SMILES | CC(=O)[C@@]3(OC(C)=O)CC[C@H]2[C@@H]4CC=C1C[C@H](CC[C@]1(C)[C@H]4CC[C@@]23C)OC=O |
| InChI | 1S/C24H34O5/c1-15(26)24(29-16(2)27)12-9-21-19-6-5-17-13-18(28-14-25)7-10-22(17,3)20(19)8-11-23(21,24)4/h5,14,18-21H,6-13H2,1-4H3/t18-,19+,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | MPCDURSOWQINER-IWMXCVPLSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.02°C at 760 mmHg (Cal.) |
| Flash point | 210.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta)-3-(Formyloxy)-20-oxopregn-5-en-17-yl acetate |