|
CAS#: 84029-89-0 Product: (2-Chloro-6-Nitrophenyl)Methyl Acrylate No suppilers available for the product. |
| Name | (2-Chloro-6-Nitrophenyl)Methyl Acrylate |
|---|---|
| Synonyms | (2-Chloro-6-Nitro-Phenyl)Methyl Prop-2-Enoate; Prop-2-Enoic Acid (2-Chloro-6-Nitrophenyl)Methyl Ester; Acrylic Acid (2-Chloro-6-Nitro-Benzyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClNO4 |
| Molecular Weight | 241.63 |
| CAS Registry Number | 84029-89-0 |
| EINECS | 281-760-2 |
| SMILES | C1=CC=C([N+]([O-])=O)C(=C1Cl)COC(=O)C=C |
| InChI | 1S/C10H8ClNO4/c1-2-10(13)16-6-7-8(11)4-3-5-9(7)12(14)15/h2-5H,1,6H2 |
| InChIKey | XXUNKTOVRVXXGY-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.197°C at 760 mmHg (Cal.) |
| Flash point | 149.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chloro-6-Nitrophenyl)Methyl Acrylate |