|
CAS#: 84030-51-3 Product: (5-Acetamido-2-Methoxyphenyl)Bis(2-Acetoxyethyl)Ammonium Acetate No suppilers available for the product. |
| Name | (5-Acetamido-2-Methoxyphenyl)Bis(2-Acetoxyethyl)Ammonium Acetate |
|---|---|
| Synonyms | (5-Acetamido-2-Methoxy-Phenyl)-Bis(2-Acetoxyethyl)Ammonium Acetate; (5-Acetamido-2-Methoxyphenyl)-Bis(2-Acetoxyethyl)Ammonium Acetate; (5-Acetamido-2-Methoxy-Phenyl)-Bis(2-Acetyloxyethyl)Azanium Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28N2O8 |
| Molecular Weight | 412.44 |
| CAS Registry Number | 84030-51-3 |
| EINECS | 281-826-0 |
| SMILES | C1=C(NC(=O)C)C=CC(=C1[NH+](CCOC(=O)C)CCOC(=O)C)OC.CC([O-])=O |
| InChI | 1S/C17H24N2O6.C2H4O2/c1-12(20)18-15-5-6-17(23-4)16(11-15)19(7-9-24-13(2)21)8-10-25-14(3)22;1-2(3)4/h5-6,11H,7-10H2,1-4H3,(H,18,20);1H3,(H,3,4) |
| InChIKey | UYNYBIGIXRLSBQ-UHFFFAOYSA-N |
| Boiling point | 526.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 272.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5-Acetamido-2-Methoxyphenyl)Bis(2-Acetoxyethyl)Ammonium Acetate |