Online Database of Chemicals from Around the World
|
CAS#: 84083-16-9 Product: 4-[(4-Anilinophenyl)Azo]Phenol No suppilers available for the product. |
| Name | 4-[(4-Anilinophenyl)Azo]Phenol |
|---|---|
| Synonyms | 4-[[4-(Phenylamino)Phenyl]Hydrazono]Cyclohexa-2,5-Dien-1-One; 4-[[4-(Phenylamino)Phenyl]Hydrazono]-1-Cyclohexa-2,5-Dienone |
| Molecular Structure | ![CAS#: 84083-16-9, 4-[(4-Anilinophenyl)Azo]Phenol](/moreStructures/84083-16-9.gif) |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 |
| CAS Registry Number | 84083-16-9 |
| EINECS | 282-065-7 |
| SMILES | C2=C(NC1=CC=CC=C1)C=CC(=C2)NN=C3C=CC(=O)C=C3 |
| InChI | 1S/C18H15N3O/c22-18-12-10-17(11-13-18)21-20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19-20H |
| InChIKey | BKXFLGYBZVQHNS-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.204°C at 760 mmHg (Cal.) |
| Flash point | 238.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Anilinophenyl)Azo]Phenol |