|
CAS#: 84083-17-0 Product: 3-[4-(Diethylamino)phenyl]-3-(4-methylphenyl)-2-benzofuran-1(3H)-one No suppilers available for the product. |
| Name | 3-[4-(Diethylamino)phenyl]-3-(4-methylphenyl)-2-benzofuran-1(3H)-one |
|---|---|
| Synonyms | 3-[4-(diethylamino)phenyl]-3-(p-tolyl)phthalide |
| Molecular Structure | ![]() |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.47 |
| CAS Registry Number | 84083-17-0 |
| EINECS | 282-066-2 |
| SMILES | CCN(CC)c1ccc(cc1)C3(OC(=O)c2ccccc23)c4ccc(C)cc4 |
| InChI | 1S/C25H25NO2/c1-4-26(5-2)21-16-14-20(15-17-21)25(19-12-10-18(3)11-13-19)23-9-7-6-8-22(23)24(27)28-25/h6-17H,4-5H2,1-3H3 |
| InChIKey | ITVGBYWULHOXRJ-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.506°C at 760 mmHg (Cal.) |
| Flash point | 170.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[4-(Diethylamino)phenyl]-3-(4-methylphenyl)-2-benzofuran-1(3H)-one |