|
CAS#: 84100-12-9 Product: 5,6,6,7,7,7-Hexafluoro-4-(Trifluoromethyl)Hepta-1,4-Diene No suppilers available for the product. |
| Name | 5,6,6,7,7,7-Hexafluoro-4-(Trifluoromethyl)Hepta-1,4-Diene |
|---|---|
| Synonyms | 5,6,6,7,7,7-Hexafluoro-4-(Trifluoromethyl)Hepta-1,4-Diene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5F9 |
| Molecular Weight | 272.11 |
| CAS Registry Number | 84100-12-9 |
| EINECS | 282-094-5 |
| SMILES | C(/C(=C(/F)C(F)(F)C(F)(F)F)C(F)(F)F)C=C |
| InChI | 1S/C8H5F9/c1-2-3-4(7(12,13)14)5(9)6(10,11)8(15,16)17/h2H,1,3H2/b5-4- |
| InChIKey | OMUNRUKWZBLGRN-PLNGDYQASA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 119.367°C at 760 mmHg (Cal.) |
| Flash point | 30.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,6,7,7,7-Hexafluoro-4-(Trifluoromethyl)Hepta-1,4-Diene |