|
CAS#: 84100-56-1 Product: 2-(Chloro-2-Thienylmethylene)Butyraldehyde No suppilers available for the product. |
| Name | 2-(Chloro-2-Thienylmethylene)Butyraldehyde |
|---|---|
| Synonyms | (2E)-2-[Chloro-(2-Thienyl)Methylene]Butanal; (E)-3-Chloro-2-Ethyl-3-(2-Thienyl)Acrolein; (2E)-2-(Chloro-Thiophen-2-Yl-Methylidene)Butanal |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClOS |
| Molecular Weight | 200.68 |
| CAS Registry Number | 84100-56-1 |
| EINECS | 282-136-2 |
| SMILES | C1=C(SC=C1)/C(Cl)=C(/CC)C=O |
| InChI | 1S/C9H9ClOS/c1-2-7(6-11)9(10)8-4-3-5-12-8/h3-6H,2H2,1H3/b9-7+ |
| InChIKey | IBTAMKGCTMRRHI-VQHVLOKHSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.711°C at 760 mmHg (Cal.) |
| Flash point | 130.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloro-2-Thienylmethylene)Butyraldehyde |