Online Database of Chemicals from Around the World
|
CAS#: 84110-41-8 Product: 3-Methyl-4-Pentenyl 2-Methylisocrotonate No suppilers available for the product. |
| Name | 3-Methyl-4-Pentenyl 2-Methylisocrotonate |
|---|---|
| Synonyms | (Z)-2-Methylbut-2-Enoic Acid 3-Methylpent-4-Enyl Ester; 3-Methyl-4-Pentenyl 2-Methylisocrotonate |
| Molecular Structure |  |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 84110-41-8 |
| EINECS | 282-176-0 |
| SMILES | C(C(C)C=C)COC(=O)C(/C)=C\C |
| InChI | 1S/C11H18O2/c1-5-9(3)7-8-13-11(12)10(4)6-2/h5-6,9H,1,7-8H2,2-4H3/b10-6- |
| InChIKey | JJUUVGROFZPNOE-POHAHGRESA-N |
| Density | 0.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.04°C at 760 mmHg (Cal.) |
| Flash point | 101.553°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-Pentenyl 2-Methylisocrotonate |