|
CAS#: 84145-51-7 Product: Tetrahydro-2,4-Dimethyl-6-Phenyl-2H-Pyran-4-Ol No suppilers available for the product. |
| Name | Tetrahydro-2,4-Dimethyl-6-Phenyl-2H-Pyran-4-Ol |
|---|---|
| Synonyms | 2,4-Dimethyl-6-Phenyl-Tetrahydropyran-4-Ol; 2,4-Dimethyl-6-Phenyl-4-Tetrahydropyranol; 2,4-Dimethyl-6-Phenyl-Oxan-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 84145-51-7 |
| EINECS | 282-278-5 |
| SMILES | C2=C(C1OC(CC(O)(C1)C)C)C=CC=C2 |
| InChI | 1S/C13H18O2/c1-10-8-13(2,14)9-12(15-10)11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3 |
| InChIKey | GTDWBOZGGBDJGL-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.461°C at 760 mmHg (Cal.) |
| Flash point | 143.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrahydro-2,4-Dimethyl-6-Phenyl-2H-Pyran-4-Ol |