|
CAS#: 84195-75-5 Product: Vinyl 2,2,5,5-Tetramethylhexanoate No suppilers available for the product. |
| Name | Vinyl 2,2,5,5-Tetramethylhexanoate |
|---|---|
| Synonyms | Vinyl 2,2,5,5-Tetramethylhexanoate; 2,2,5,5-Tetramethylhexanoic Acid Vinyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 84195-75-5 |
| EINECS | 282-382-0 |
| SMILES | C(C(C(OC=C)=O)(C)C)CC(C)(C)C |
| InChI | 1S/C12H22O2/c1-7-14-10(13)12(5,6)9-8-11(2,3)4/h7H,1,8-9H2,2-6H3 |
| InChIKey | KHRVSSXNHCFXGA-UHFFFAOYSA-N |
| Density | 0.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.883°C at 760 mmHg (Cal.) |
| Flash point | 77.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyl 2,2,5,5-Tetramethylhexanoate |