|
CAS#: 84196-22-5 Product: 4-(Phenyldiazenyl)-1,3-benzenediamine sulfate (2:1) No suppilers available for the product. |
| Name | 4-(Phenyldiazenyl)-1,3-benzenediamine sulfate (2:1) |
|---|---|
| Synonyms | bis[4-(phenylazo)benzene-1,3-diamine] sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26N8O4S |
| Molecular Weight | 522.58 |
| CAS Registry Number | 84196-22-5 |
| EINECS | 282-432-1 |
| SMILES | OS(O)(=O)=O.Nc2ccc(N=Nc1ccccc1)c(N)c2.Nc2ccc(N=Nc1ccccc1)c(N)c2 |
| InChI | 1S/2C12H12N4.H2O4S/c2*13-9-6-7-12(11(14)8-9)16-15-10-4-2-1-3-5-10;1-5(2,3)4/h2*1-8H,13-14H2;(H2,1,2,3,4) |
| InChIKey | RFJSYECVGBBDGY-UHFFFAOYSA-N |
| Boiling point | 852.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 469.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Phenyldiazenyl)-1,3-benzenediamine sulfate (2:1) |