| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | S(-)-Eticlopride Hydrochloride |
|---|---|
| Synonyms | 5-Chloro-3-Ethyl-N-[[(2S)-1-Ethylpyrrolidin-2-Yl]Methyl]-2-Hydroxy-6-Methoxy-Benzamide; 5-Chloro-3-Ethyl-N-[[(2S)-1-Ethyl-2-Pyrrolidinyl]Methyl]-2-Hydroxy-6-Methoxybenzamide; Prestwick3_000932 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 |
| CAS Registry Number | 84226-12-0 |
| SMILES | [C@@H]1(N(CCC1)CC)CNC(=O)C2=C(OC)C(=CC(=C2O)CC)Cl |
| InChI | 1S/C17H25ClN2O3/c1-4-11-9-13(18)16(23-3)14(15(11)21)17(22)19-10-12-7-6-8-20(12)5-2/h9,12,21H,4-8,10H2,1-3H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | AADCDMQTJNYOSS-LBPRGKRZSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.823°C at 760 mmHg (Cal.) |
| Flash point | 214.355°C (Cal.) |
| (1) | Carlsson et al.. Ligand discovery from a dopamine D3 receptor homology model and crystal structure, Nature Chemical Biology, 2011 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for S(-)-Eticlopride Hydrochloride |