|
CAS#: 84235-43-8 Product: 4-Isopropyl-1-methylbicyclo[2.2.2]oct-5-ene-2-carbonitrile No suppilers available for the product. |
| Name | 4-Isopropyl-1-methylbicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 |
| CAS Registry Number | 84235-43-8 |
| EINECS | 282-469-3 |
| SMILES | CC(C)C12C=CC(C)(CC1)C(C2)C#N |
| InChI | 1S/C13H19N/c1-10(2)13-6-4-12(3,5-7-13)11(8-13)9-14/h4,6,10-11H,5,7-8H2,1-3H3 |
| InChIKey | MLPBPJJSDXCCHW-UHFFFAOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.637°C at 760 mmHg (Cal.) |
| Flash point | 98.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropyl-1-methylbicyclo[2.2.2]oct-5-ene-2-carbonitrile |