|
CAS#: 84268-08-6 Product: 3-[3-(2-Benzotriazolyl)-5-tert-butyl-4-hydroxyphenyl]propanoic acid hexyl ester No suppilers available for the product. |
| Name | 3-[3-(2-Benzotriazolyl)-5-tert-butyl-4-hydroxyphenyl]propanoic acid hexyl ester |
|---|---|
| Synonyms | Hexyl 3-[3-(Benzotriazol-2-Yl)-5-Tert-Butyl-4-Hydroxy-Phenyl]Propanoate; 3-[3-(2-Benzotriazolyl)-5-Tert-Butyl-4-Hydroxyphenyl]Propanoic Acid Hexyl Ester; 3-[3-(Benzotriazol-2-Yl)-5-Tert-Butyl-4-Hydroxy-Phenyl]Propionic Acid Hexyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.55 |
| CAS Registry Number | 84268-08-6 |
| SMILES | C1=C(C(=C(C=C1CCC(=O)OCCCCCC)[N]2N=C3C(=N2)C=CC=C3)O)C(C)(C)C |
| InChI | 1S/C25H33N3O3/c1-5-6-7-10-15-31-23(29)14-13-18-16-19(25(2,3)4)24(30)22(17-18)28-26-20-11-8-9-12-21(20)27-28/h8-9,11-12,16-17,30H,5-7,10,13-15H2,1-4H3 |
| InChIKey | LUZAAKNZQSYDKP-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.935°C at 760 mmHg (Cal.) |
| Flash point | 288.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[3-(2-Benzotriazolyl)-5-tert-butyl-4-hydroxyphenyl]propanoic acid hexyl ester |