|
CAS#: 84282-27-9 Product: Bromoethyl Bromopentyl Chloroethyl Phosphate No suppilers available for the product. |
| Name | Bromoethyl Bromopentyl Chloroethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid 1-Bromoethyl 1-Bromopentyl 1-Chloroethyl Ester; Bromoethyl Bromopentyl Chloroethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Br2ClO4P |
| Molecular Weight | 416.47 |
| CAS Registry Number | 84282-27-9 |
| EINECS | 282-674-8 |
| SMILES | C(C(Br)O[P](OC(Br)C)(OC(Cl)C)=O)CCC |
| InChI | 1S/C9H18Br2ClO4P/c1-4-5-6-9(11)16-17(13,14-7(2)10)15-8(3)12/h7-9H,4-6H2,1-3H3 |
| InChIKey | LWHHGPFJIZSUHT-UHFFFAOYSA-N |
| Density | 1.607g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.913°C at 760 mmHg (Cal.) |
| Flash point | 170.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bromoethyl Bromopentyl Chloroethyl Phosphate |