|
CAS#: 84308-82-7 Product: N2-(P-Isopropoxyphenyl)-N1-Phenylacetamidine No suppilers available for the product. |
| Name | N2-(P-Isopropoxyphenyl)-N1-Phenylacetamidine |
|---|---|
| Synonyms | N'-(4-Isopropoxyphenyl)-N-Phenyl-Acetamidine; N'-(4-Isopropoxyphenyl)-N-Phenylacetamidine; 4-13-00-01094 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 |
| CAS Registry Number | 84308-82-7 |
| SMILES | C2=C(N=C(NC1=CC=CC=C1)C)C=CC(=C2)OC(C)C |
| InChI | 1S/C17H20N2O/c1-13(2)20-17-11-9-16(10-12-17)19-14(3)18-15-7-5-4-6-8-15/h4-13H,1-3H3,(H,18,19) |
| InChIKey | BNSJBTVCHDAPFM-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.731°C at 760 mmHg (Cal.) |
| Flash point | 211.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-(P-Isopropoxyphenyl)-N1-Phenylacetamidine |