|
CAS#: 84331-66-8 Product: (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 1,3-Dimethyl-7 H-Purine-2,6-Dione No suppilers available for the product. |
| Name | (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 1,3-Dimethyl-7 H-Purine-2,6-Dione |
|---|---|
| Synonyms | (2S)-2-Amino-5-Guanidino-Pentanoic Acid; 1,3-Dimethyl-7H-Purine-2,6-Dione; (2S)-2-Amino-5-Guanidinopentanoic Acid; 1,3-Dimethyl-7H-Purine-2,6-Dione; (2S)-2-Amino-5-Guanidino-Valeric Acid; 1,3-Dimethyl-7H-Purine-2,6-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22N8O4 |
| Molecular Weight | 354.37 |
| CAS Registry Number | 84331-66-8 |
| SMILES | [C@H](N)(CCCN=C(N)N)C(O)=O.C1=NC2=C([NH]1)C(=O)N(C(=O)N2C)C |
| InChI | 1S/C7H8N4O2.C6H14N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;7-4(5(11)12)2-1-3-10-6(8)9/h3H,1-2H3,(H,8,9);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | GZKSGVLHWLGYRF-VWMHFEHESA-N |
| Boiling point | 454.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 1,3-Dimethyl-7 H-Purine-2,6-Dione |