|
CAS#: 84332-94-5 Product: N-Ethylethanaminium (5-hydroxy-1H-indol-3-yl)acetate No suppilers available for the product. |
| Name | N-Ethylethanaminium (5-hydroxy-1H-indol-3-yl)acetate |
|---|---|
| Synonyms | diethylammonium 5-hydroxy-1H-indole-3-acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 84332-94-5 |
| EINECS | 282-723-3 |
| SMILES | CC[NH2+]CC.[O-]C(=O)Cc2cnc1ccc(O)cc12 |
| InChI | 1S/C10H9NO3.C4H11N/c12-7-1-2-9-8(4-7)6(5-11-9)3-10(13)14;1-3-5-4-2/h1-2,4-5,11-12H,3H2,(H,13,14);5H,3-4H2,1-2H3 |
| InChIKey | KKOLPWAHCOUOMP-UHFFFAOYSA-N |
| Boiling point | 498.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 255.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethylethanaminium (5-hydroxy-1H-indol-3-yl)acetate |