|
CAS#: 84393-64-6 Product: 2-Carbomethoxy-A-Nor-5 alpha-Cholestan-3-One No suppilers available for the product. |
| Name | 2-Carbomethoxy-A-Nor-5 alpha-Cholestan-3-One |
|---|---|
| Synonyms | 2-Carbomethoxy-A-Nor-5Alpha-Cholestan-3-One; 2-Cmnco |
| Molecular Structure | ![]() |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 |
| CAS Registry Number | 84393-64-6 |
| SMILES | [C@H]4([C@@]2([C@H]([C@@H]1CC[C@@H]3[C@@]([C@H]1CC2)(C(CC3=O)C(=O)OC)C)CC4)C)[C@@H](CCCC(C)C)C |
| InChI | 1S/C28H46O3/c1-17(2)8-7-9-18(3)20-12-13-21-19-10-11-23-25(29)16-24(26(30)31-6)28(23,5)22(19)14-15-27(20,21)4/h17-24H,7-16H2,1-6H3/t18-,19+,20-,21+,22+,23+,24?,27-,28-/m1/s1 |
| InChIKey | PJSICHQRUIZDEW-JRPMKIQBSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.45°C at 760 mmHg (Cal.) |
| Flash point | 209.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Carbomethoxy-A-Nor-5 alpha-Cholestan-3-One |