|
CAS#: 84434-42-4 Product: 2-Methyl-6-(Phenylazo)Benzene-1,3-Diamine No suppilers available for the product. |
| Name | 2-Methyl-6-(Phenylazo)Benzene-1,3-Diamine |
|---|---|
| Synonyms | 2-Methyl-4-Phenylazo-Benzene-1,3-Diamine; 2-Methyl-4-Phenylazobenzene-1,3-Diamine; (3-Amino-2-Methyl-6-Phenylazo-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 |
| CAS Registry Number | 84434-42-4 |
| EINECS | 282-841-5 |
| SMILES | C2=C(N=NC1=CC=CC=C1)C(=C(C(=C2)N)C)N |
| InChI | 1S/C13H14N4/c1-9-11(14)7-8-12(13(9)15)17-16-10-5-3-2-4-6-10/h2-8H,14-15H2,1H3 |
| InChIKey | CAGBLWRDOQVQDD-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.42°C at 760 mmHg (Cal.) |
| Flash point | 224.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-6-(Phenylazo)Benzene-1,3-Diamine |